Products 88296-62-2
CAS 88296-62-2 appears in our catalog under these names: Transcainide/ 100%, Transcainide. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 1 mg.
4-(dimethylamino)-N-(2,6-dimethylphenyl)-1-[(1R,2R)-2-hydroxycyclohexyl]piperidine-4-carboxamide (CAS 88296-62-2) is a chemical compound with the molecular formula C22H35N3O2 and a molecular weight of 373.5 g/mol. IUPAC name: 4-(dimethylamino)-N-(2,6-dimethylphenyl)-1-[(1R,2R)-2-hydroxycyclohexyl]piperidine-4-carboxamide. InChIKey: MFKCGXDCHAFQQZ-RTBURBONSA-N.
| Molecular formula | C22H35N3O2 |
|---|---|
| Molecular weight | 373.5 g/mol |
| IUPAC name | 4-(dimethylamino)-N-(2,6-dimethylphenyl)-1-[(1R,2R)-2-hydroxycyclohexyl]piperidine-4-carboxamide |
| InChIKey | MFKCGXDCHAFQQZ-RTBURBONSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C2(CCN(CC2)[C@@H]3CCCC[C@H]3O)N(C)C |
Computed by PubChem (NCBI)