CAS 882977-79-9 is the registry number for 5,6-Dichloro-2-(2,2,2-trifluoroethyl)-1H-benzo[d]imidazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dichloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole (CAS 882977-79-9) is a chemical compound with the molecular formula C9H5Cl2F3N2 and a molecular weight of 269.05 g/mol. IUPAC name: 5,6-dichloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole. InChIKey: WTPSGAGGBLVYRS-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2F3N2 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 5,6-dichloro-2-(2,2,2-trifluoroethyl)-1H-benzimidazole |
| InChIKey | WTPSGAGGBLVYRS-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)N=C(N2)CC(F)(F)F |
Computed by PubChem (NCBI)