CAS 883003-62-1 appears in our catalog under these names: FUBP1-IN-1, FUBP1-IN-1, 99+%, FUBP1-IN-1, 99.72%, FUBP1-IN-1 (Standard), FUBP1-IN-1/ 99.81% (existing batch purity). Offered by: Biosynth, Chemat, AmBeed, MedChemExpress, TargetMol. Available pack sizes: 50mg, 25mg, 100mg, 1mg, 5mg, 10mg, 200mg, 25 mg.
5-(3,4-dimethoxyphenyl)-2-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine (CAS 883003-62-1) is a chemical compound with the molecular formula C19H14F3N3O2S and a molecular weight of 405.4 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-2-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine. InChIKey: CLFOYJSEPPNFQZ-UHFFFAOYSA-N.
| Molecular formula | C19H14F3N3O2S |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-2-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine |
| InChIKey | CLFOYJSEPPNFQZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=CC(=NN3C(=C2)C(F)(F)F)C4=CC=CS4)OC |
Computed by PubChem (NCBI)