CAS 883028-78-2 is the registry number for RJF02215. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide (CAS 883028-78-2) is a chemical compound with the molecular formula C17H12ClN3OS3 and a molecular weight of 405.9 g/mol. IUPAC name: N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide. InChIKey: AWODPWQHYCUQQI-UHFFFAOYSA-N.
| Molecular formula | C17H12ClN3OS3 |
|---|---|
| Molecular weight | 405.9 g/mol |
| IUPAC name | N-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-thiophen-2-ylprop-2-enamide |
| InChIKey | AWODPWQHYCUQQI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C=CC(=O)NC(=S)NC2=NC(=CS2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)