CAS 883028-82-8 is the registry number for 3-(4-(Trifluoromethoxy)phenyl)-1,2,4-oxadiazole-5-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-5-carbohydrazide (CAS 883028-82-8) is a chemical compound with the molecular formula C10H7F3N4O3 and a molecular weight of 288.18 g/mol. IUPAC name: 3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-5-carbohydrazide. InChIKey: YRNKLMFDYOTVIN-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N4O3 |
|---|---|
| Molecular weight | 288.18 g/mol |
| IUPAC name | 3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole-5-carbohydrazide |
| InChIKey | YRNKLMFDYOTVIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)C(=O)NN)OC(F)(F)F |
Computed by PubChem (NCBI)