CAS 883031-03-6 appears in our catalog under these names: Hc-067047, 95%, HC 067047, HC-067047/ 99.79% (existing batch purity), HC 067047, HC-067047. Offered by: Combi-blocks, Hubei YoungXin, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 200mg, 1mg, 5mg, 10mM (in 1ml dmso).
2-methyl-1-(3-morpholin-4-ylpropyl)-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (CAS 883031-03-6) is a chemical compound with the molecular formula C26H28F3N3O2 and a molecular weight of 471.5 g/mol. IUPAC name: 2-methyl-1-(3-morpholin-4-ylpropyl)-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide. InChIKey: NCZYSQOTAYFTNM-UHFFFAOYSA-N.
| Molecular formula | C26H28F3N3O2 |
|---|---|
| Molecular weight | 471.5 g/mol |
| IUPAC name | 2-methyl-1-(3-morpholin-4-ylpropyl)-5-phenyl-N-[3-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| InChIKey | NCZYSQOTAYFTNM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1CCCN2CCOCC2)C3=CC=CC=C3)C(=O)NC4=CC=CC(=C4)C(F)(F)F |
Computed by PubChem (NCBI)