Products 883130-46-9

CAS 883130-46-9 is the registry number for Methyl (E)-3-(dimethylamino)prop-2-enimidothioate hydroiodide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (E)-3-(dimethylamino)prop-2-enimidothioate;hydroiodide (CAS 883130-46-9) is a chemical compound with the molecular formula C6H13IN2S and a molecular weight of 272.15 g/mol. IUPAC name: methyl (E)-3-(dimethylamino)prop-2-enimidothioate;hydroiodide. InChIKey: LWSOHHGRFVNDAK-MHARGJJLSA-N.

Identity
Molecular formulaC6H13IN2S
Molecular weight272.15 g/mol
IUPAC namemethyl (E)-3-(dimethylamino)prop-2-enimidothioate;hydroiodide
InChIKeyLWSOHHGRFVNDAK-MHARGJJLSA-N
SMILESCN(C)/C=C/C(=N)SC.I

Computed by PubChem (NCBI)