CAS 883288-78-6 appears in our catalog under these names: Glycerophosphorylethanolamine (sodium salt), Glycerophosphorylethanolamine (sodium salt), Glycerophosphorylethanolamine (sodium). Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
Sodium 2-aminoethyl 2,3-dihydroxypropyl phosphate (CAS 883288-78-6) is a chemical compound with the molecular formula C5H13NNaO6P and a molecular weight of 237.12 g/mol. IUPAC name: sodium 2-aminoethyl 2,3-dihydroxypropyl phosphate. InChIKey: LMVDUYIAODUIQA-UHFFFAOYSA-M.
| Molecular formula | C5H13NNaO6P |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | sodium 2-aminoethyl 2,3-dihydroxypropyl phosphate |
| InChIKey | LMVDUYIAODUIQA-UHFFFAOYSA-M |
| SMILES | C(COP(=O)([O-])OCC(CO)O)N.[Na+] |
Computed by PubChem (NCBI)