CAS 883514-29-2 appears in our catalog under these names: 1-(2-Bromo-4-fluorophenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(2-Bromo-4-fluorophenyl)-2,5-dimethyl-1H-pyrrole, 97%, 1-(2-Bromo-4-fluorophenyl)-2,5-dimethyl-1H-pyrrole, ≥95%, ≥95%, 1-(2-Bromo-4-fluorophenyl)-2,5-dimethyl-1H-pyrrole. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-(2-bromo-4-fluorophenyl)-2,5-dimethylpyrrole (CAS 883514-29-2) is a chemical compound with the molecular formula C12H11BrFN and a molecular weight of 268.12 g/mol. IUPAC name: 1-(2-bromo-4-fluorophenyl)-2,5-dimethylpyrrole. InChIKey: FAUJIJHPWBIQLE-UHFFFAOYSA-N.
| Molecular formula | C12H11BrFN |
|---|---|
| Molecular weight | 268.12 g/mol |
| IUPAC name | 1-(2-bromo-4-fluorophenyl)-2,5-dimethylpyrrole |
| InChIKey | FAUJIJHPWBIQLE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C=C(C=C2)F)Br)C |
Computed by PubChem (NCBI)