CAS 883546-00-7 is the registry number for 4-(Perfluorocyclohexyl)butan-1-ol, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)butan-1-ol (CAS 883546-00-7) is a chemical compound with the molecular formula C10H9F11O and a molecular weight of 354.16 g/mol. IUPAC name: 4-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)butan-1-ol. InChIKey: BEMDKZLEDMTSTG-UHFFFAOYSA-N.
| Molecular formula | C10H9F11O |
|---|---|
| Molecular weight | 354.16 g/mol |
| IUPAC name | 4-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)butan-1-ol |
| InChIKey | BEMDKZLEDMTSTG-UHFFFAOYSA-N |
| SMILES | C(CCO)CC1(C(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)