CAS 883715-23-9 appears in our catalog under these names: Macamide Impurity 1, Macamide Impurity 14, N-(3-Methoxybenzyl)-(9Z,12Z,15Z)-octadecatrienamide/ 98.66% (existing batch purity), N-(3-Methoxybenzyl)-(9Z,12Z,15Z)-octadecatrienamide, N-(3-Methoxybenzyl)-(9Z,12Z,15Z)-octadecatrienamide, 99.48%. Offered by: Chemat Brand, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 50mg, 25mg, 100mg, 10mg, 10 mg.
(9Z,12Z,15Z)-N-[(3-methoxyphenyl)methyl]octadeca-9,12,15-trienamide (CAS 883715-23-9) is a chemical compound with the molecular formula C26H39NO2 and a molecular weight of 397.6 g/mol. IUPAC name: (9Z,12Z,15Z)-N-[(3-methoxyphenyl)methyl]octadeca-9,12,15-trienamide. InChIKey: XKHCEDYSKNATME-YSTUJMKBSA-N.
| Molecular formula | C26H39NO2 |
|---|---|
| Molecular weight | 397.6 g/mol |
| IUPAC name | (9Z,12Z,15Z)-N-[(3-methoxyphenyl)methyl]octadeca-9,12,15-trienamide |
| InChIKey | XKHCEDYSKNATME-YSTUJMKBSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCC1=CC(=CC=C1)OC |
Computed by PubChem (NCBI)