Products 883731-94-0

CAS 883731-94-0 is the registry number for (1-((Tosyloxy)methyl)cyclopropyl)methyl benzoate, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.

[1-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl benzoate (CAS 883731-94-0) is a chemical compound with the molecular formula C19H20O5S and a molecular weight of 360.4 g/mol. IUPAC name: [1-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl benzoate. InChIKey: BYQPCTVKKOQNNN-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20O5S
Molecular weight360.4 g/mol
IUPAC name[1-[(4-methylphenyl)sulfonyloxymethyl]cyclopropyl]methyl benzoate
InChIKeyBYQPCTVKKOQNNN-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCC2(CC2)COC(=O)C3=CC=CC=C3

Computed by PubChem (NCBI)