CAS 883898-93-9 appears in our catalog under these names: 4-Chloro-2-(5-isopropyl-4,4-dimethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%, 4–Chloro–2–(5,5–dimethyl–1,3,2–dioxaborinan–2–yl)benzonitrile. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile (CAS 883898-93-9) is a chemical compound with the molecular formula C12H13BClNO2 and a molecular weight of 249.50 g/mol. IUPAC name: 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile. InChIKey: JUJHSJFBHCQGCU-UHFFFAOYSA-N.
| Molecular formula | C12H13BClNO2 |
|---|---|
| Molecular weight | 249.50 g/mol |
| IUPAC name | 4-chloro-2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile |
| InChIKey | JUJHSJFBHCQGCU-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=CC(=C2)Cl)C#N |
Computed by PubChem (NCBI)