CAS 883898-98-4 appears in our catalog under these names: 2-Cyano-4-trifluoromethylphenylboronic acid neopentyl glycol ester, 95%, 2-Cyano-4-trifluoromethylphenylboronic acid neopentyl glycol ester, 95%, 95%, 2-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-5-(trifluoromethyl)benzonitrile, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-(trifluoromethyl)benzonitrile (CAS 883898-98-4) is a chemical compound with the molecular formula C13H13BF3NO2 and a molecular weight of 283.06 g/mol. IUPAC name: 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-(trifluoromethyl)benzonitrile. InChIKey: VJLXENOHERNTEB-UHFFFAOYSA-N.
| Molecular formula | C13H13BF3NO2 |
|---|---|
| Molecular weight | 283.06 g/mol |
| IUPAC name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-5-(trifluoromethyl)benzonitrile |
| InChIKey | VJLXENOHERNTEB-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=C(C=C2)C(F)(F)F)C#N |
Computed by PubChem (NCBI)