CAS 883899-07-8 appears in our catalog under these names: 2-Bromo-6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile, 95-<97%, 3-BROMO-2-CYANOPHENYLBORONIC ACID NEOPENTYL GLYCOL ESTER, 95%, 95%. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 100mg, 250mg.
2-bromo-6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile (CAS 883899-07-8) is a chemical compound with the molecular formula C12H13BBrNO2 and a molecular weight of 293.95 g/mol. IUPAC name: 2-bromo-6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile. InChIKey: CULSSICMSNLRST-UHFFFAOYSA-N.
| Molecular formula | C12H13BBrNO2 |
|---|---|
| Molecular weight | 293.95 g/mol |
| IUPAC name | 2-bromo-6-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile |
| InChIKey | CULSSICMSNLRST-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C(=CC=C2)Br)C#N |
Computed by PubChem (NCBI)