Products 88393-81-1

CAS 88393-81-1 is the registry number for Ethyl 5-hydroxy-1,2-oxazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 5-oxo-2H-1,2-oxazole-3-carboxylate (CAS 88393-81-1) is a chemical compound with the molecular formula C6H7NO4 and a molecular weight of 157.12 g/mol. IUPAC name: ethyl 5-oxo-2H-1,2-oxazole-3-carboxylate. InChIKey: CDZUEOIXZYSNKF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO4
Molecular weight157.12 g/mol
IUPAC nameethyl 5-oxo-2H-1,2-oxazole-3-carboxylate
InChIKeyCDZUEOIXZYSNKF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=O)ON1

Computed by PubChem (NCBI)