CAS 884010-25-7 appears in our catalog under these names: 5-Bromobenzo[b]thiophene-2-boronic acid, 98%, (5-Bromobenzo(b)thiophen-2-yl)boronic acid, 98%, (5-Bromobenzo[b]thiophen-2-yl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
(5-bromo-1-benzothiophen-2-yl)boronic acid (CAS 884010-25-7) is a chemical compound with the molecular formula C8H6BBrO2S and a molecular weight of 256.92 g/mol. IUPAC name: (5-bromo-1-benzothiophen-2-yl)boronic acid. InChIKey: RUQKSUMPFAJLNQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BBrO2S |
|---|---|
| Molecular weight | 256.92 g/mol |
| IUPAC name | (5-bromo-1-benzothiophen-2-yl)boronic acid |
| InChIKey | RUQKSUMPFAJLNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(S1)C=CC(=C2)Br)(O)O |
Computed by PubChem (NCBI)