CAS 88444-78-4 is the registry number for 2-Ethynyl-1,4-bis(trifluoromethyl)benzene, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethynyl-1,4-bis(trifluoromethyl)benzene (CAS 88444-78-4) is a chemical compound with the molecular formula C10H4F6 and a molecular weight of 238.13 g/mol. IUPAC name: 2-ethynyl-1,4-bis(trifluoromethyl)benzene. InChIKey: RENRBYCWFFOHIG-UHFFFAOYSA-N.
| Molecular formula | C10H4F6 |
|---|---|
| Molecular weight | 238.13 g/mol |
| IUPAC name | 2-ethynyl-1,4-bis(trifluoromethyl)benzene |
| InChIKey | RENRBYCWFFOHIG-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)