CAS 884494-91-1 appears in our catalog under these names: 2,4-Dibromo-5-fluoro-3-nitropyridine 95%, 2,4-Dibromo-5-fluoro-3-nitropyridine, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
2,4-dibromo-5-fluoro-3-nitropyridine (CAS 884494-91-1) is a chemical compound with the molecular formula C5HBr2FN2O2 and a molecular weight of 299.88 g/mol. IUPAC name: 2,4-dibromo-5-fluoro-3-nitropyridine. InChIKey: RUKHOWBZNXYATH-UHFFFAOYSA-N.
| Molecular formula | C5HBr2FN2O2 |
|---|---|
| Molecular weight | 299.88 g/mol |
| IUPAC name | 2,4-dibromo-5-fluoro-3-nitropyridine |
| InChIKey | RUKHOWBZNXYATH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Br)[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)