CAS 884497-30-7 is the registry number for 2-Amino-4-(4-sec-butylphenyl)-5-methylthiophene-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-4-(4-butan-2-ylphenyl)-5-methylthiophene-3-carbonitrile (CAS 884497-30-7) is a chemical compound with the molecular formula C16H18N2S and a molecular weight of 270.4 g/mol. IUPAC name: 2-amino-4-(4-butan-2-ylphenyl)-5-methylthiophene-3-carbonitrile. InChIKey: JTLRHJQWMVNWFI-UHFFFAOYSA-N.
| Molecular formula | C16H18N2S |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 2-amino-4-(4-butan-2-ylphenyl)-5-methylthiophene-3-carbonitrile |
| InChIKey | JTLRHJQWMVNWFI-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC=C(C=C1)C2=C(SC(=C2C#N)N)C |
Computed by PubChem (NCBI)