CAS 884520-97-2 appears in our catalog under these names: 2,2,2-Trichloroethyl trifluoromethanesulfonate, 95%, 2,2,2-Trichloroethyl trifluoromethanesulfonate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2,2-trichloroethyl trifluoromethanesulfonate (CAS 884520-97-2) is a chemical compound with the molecular formula C3H2Cl3F3O3S and a molecular weight of 281.5 g/mol. IUPAC name: 2,2,2-trichloroethyl trifluoromethanesulfonate. InChIKey: IJUHGAPHHHTBAH-UHFFFAOYSA-N.
| Molecular formula | C3H2Cl3F3O3S |
|---|---|
| Molecular weight | 281.5 g/mol |
| IUPAC name | 2,2,2-trichloroethyl trifluoromethanesulfonate |
| InChIKey | IJUHGAPHHHTBAH-UHFFFAOYSA-N |
| SMILES | C(C(Cl)(Cl)Cl)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)