CAS 88491-70-7 appears in our catalog under these names: Hydrazine Sulfate-15N2, >95% (HPLC), HYDRAZINE SULFATE-15N2, 98 ATOM % 15N. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 250mg, 500mg, 50mg.
CAS 88491-70-7 identifies a chemical compound with the molecular formula H6N2O4S and a molecular weight of 132.11 g/mol. InChIKey: ZGCHATBSUIJLRL-AWQJXPNKSA-N.
| Molecular formula | H6N2O4S |
|---|---|
| Molecular weight | 132.11 g/mol |
| InChIKey | ZGCHATBSUIJLRL-AWQJXPNKSA-N |
| SMILES | [15NH2][15NH2].OS(=O)(=O)O |
Computed by PubChem (NCBI)