CAS 885046-20-8 is the registry number for Telmisartan Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-1-methyl-2-(7-methyl-2-propyl-3H-benzimidazol-5-yl)benzimidazole (CAS 885046-20-8) is a chemical compound with the molecular formula C19H19ClN4 and a molecular weight of 338.8 g/mol. IUPAC name: 5-chloro-1-methyl-2-(7-methyl-2-propyl-3H-benzimidazol-5-yl)benzimidazole. InChIKey: PJPCVNUXOVVIEL-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN4 |
|---|---|
| Molecular weight | 338.8 g/mol |
| IUPAC name | 5-chloro-1-methyl-2-(7-methyl-2-propyl-3H-benzimidazol-5-yl)benzimidazole |
| InChIKey | PJPCVNUXOVVIEL-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1)C=C(C=C2C)C3=NC4=C(N3C)C=CC(=C4)Cl |
Computed by PubChem (NCBI)