CAS 885101-12-2 appears in our catalog under these names: N-Methyl Fluoxetine HCl, N,N-Dimethyl-3-phenyl-3-(4-(trifluoromethyl)phenoxy)propan-1-amine hydrochloride, 98%, Fluoxetine Impurity 7(EP-G), N-Methyl Fluoxetine Hydrochloride, >95% (HPLC), N-Methylfluoxetine Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N,N-dimethyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride (CAS 885101-12-2) is a chemical compound with the molecular formula C18H21ClF3NO and a molecular weight of 359.8 g/mol. IUPAC name: N,N-dimethyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride. InChIKey: LXNAWNZZEQJKCC-UHFFFAOYSA-N.
| Molecular formula | C18H21ClF3NO |
|---|---|
| Molecular weight | 359.8 g/mol |
| IUPAC name | N,N-dimethyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride |
| InChIKey | LXNAWNZZEQJKCC-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)