CAS 885227-79-2 is the registry number for 7-Bromo-2-naphthonitrile, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
7-bromonaphthalene-2-carbonitrile (CAS 885227-79-2) is a chemical compound with the molecular formula C11H6BrN and a molecular weight of 232.08 g/mol. IUPAC name: 7-bromonaphthalene-2-carbonitrile. InChIKey: ZFAPXUUMFUYDDB-UHFFFAOYSA-N.
| Molecular formula | C11H6BrN |
|---|---|
| Molecular weight | 232.08 g/mol |
| IUPAC name | 7-bromonaphthalene-2-carbonitrile |
| InChIKey | ZFAPXUUMFUYDDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)Br)C#N |
Computed by PubChem (NCBI)