CAS 885269-32-9 appears in our catalog under these names: 4-(4'-Chloro-4-biphenylylsulfonylamino)benzoic acid, 95%, 4-(4'-Chloro-(1,1'-biphenyl)-4-ylsulfonamido)benzoic acid, 98%, 4-[[(4′-Chloro[1,1′-biphenyl]-4-yl)sulfonyl]amino]benzoic acid, 98%, 98%, 4-((4'-chloro-[1,1'-biphenyl])-4-sulfonamido)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
4-[[4-(4-chlorophenyl)phenyl]sulfonylamino]benzoic acid (CAS 885269-32-9) is a chemical compound with the molecular formula C19H14ClNO4S and a molecular weight of 387.8 g/mol. IUPAC name: 4-[[4-(4-chlorophenyl)phenyl]sulfonylamino]benzoic acid. InChIKey: AYWSYJTWHIPSFL-UHFFFAOYSA-N.
| Molecular formula | C19H14ClNO4S |
|---|---|
| Molecular weight | 387.8 g/mol |
| IUPAC name | 4-[[4-(4-chlorophenyl)phenyl]sulfonylamino]benzoic acid |
| InChIKey | AYWSYJTWHIPSFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Cl)S(=O)(=O)NC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)