CAS 885269-65-8 is the registry number for 2-Chloro-N-(3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl]acetamide (CAS 885269-65-8) is a chemical compound with the molecular formula C10H7Cl2N3OS and a molecular weight of 288.15 g/mol. IUPAC name: 2-chloro-N-[3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl]acetamide. InChIKey: XKRAEVTXUCZPFP-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3OS |
|---|---|
| Molecular weight | 288.15 g/mol |
| IUPAC name | 2-chloro-N-[3-(4-chlorophenyl)-1,2,4-thiadiazol-5-yl]acetamide |
| InChIKey | XKRAEVTXUCZPFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=N2)NC(=O)CCl)Cl |
Computed by PubChem (NCBI)