CAS 885269-91-0 is the registry number for 3-[4-(4-Methoxyphenyl)phenylsulfonamido]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]benzoic acid (CAS 885269-91-0) is a chemical compound with the molecular formula C20H17NO5S and a molecular weight of 383.4 g/mol. IUPAC name: 3-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]benzoic acid. InChIKey: ZBKATECYZDJGSI-UHFFFAOYSA-N.
| Molecular formula | C20H17NO5S |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 3-[[4-(4-methoxyphenyl)phenyl]sulfonylamino]benzoic acid |
| InChIKey | ZBKATECYZDJGSI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)