CAS 885270-84-8 appears in our catalog under these names: 2,6-Diaza-spiro(3.4)octane-2-carboxylic acid tert-butylester, tert-Butyl 2,6-Diazaspiro[3.4]octane-2-carboxylate, >98.0%(GC), tert-Butyl 2,6-diazaspiro[3.4]octane-2-carboxylate, 98%, 98%, tert-Butyl 2,6-diazaspiro[3.4]octane-2-carboxylate, 95%. Offered by: Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250g, 500g, 100mg, 250mg, 10g, 25g.
Tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate (CAS 885270-84-8) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate. InChIKey: UJIOQJJFPYXAEM-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl 2,7-diazaspiro[3.4]octane-2-carboxylate |
| InChIKey | UJIOQJJFPYXAEM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCNC2 |
Computed by PubChem (NCBI)