CAS 885276-54-0 is the registry number for 1-(4-(Trifluoromethyl)phenyl)propan-1-amine, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
1-[4-(trifluoromethyl)phenyl]propan-1-amine (CAS 885276-54-0) is a chemical compound with the molecular formula C10H12F3N and a molecular weight of 203.20 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]propan-1-amine. InChIKey: YOETTZCHIABKPH-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]propan-1-amine |
| InChIKey | YOETTZCHIABKPH-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)