CAS 885277-47-4 is the registry number for 4,6-Dichloro-2-(2-fluorophenyl)quinazoline, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4,6-dichloro-2-(2-fluorophenyl)quinazoline (CAS 885277-47-4) is a chemical compound with the molecular formula C14H7Cl2FN2 and a molecular weight of 293.1 g/mol. IUPAC name: 4,6-dichloro-2-(2-fluorophenyl)quinazoline. InChIKey: WVHGYAJKRZOARX-UHFFFAOYSA-N.
| Molecular formula | C14H7Cl2FN2 |
|---|---|
| Molecular weight | 293.1 g/mol |
| IUPAC name | 4,6-dichloro-2-(2-fluorophenyl)quinazoline |
| InChIKey | WVHGYAJKRZOARX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(C=C(C=C3)Cl)C(=N2)Cl)F |
Computed by PubChem (NCBI)