CAS 885279-82-3 appears in our catalog under these names: 2-Methoxy-5-(1,3-dioxoisoindolin-2-yl)benzene-1-sulfonyl chloride, 95%, 5-(1,3-Dioxoisoindolin-2-yl)-2-methoxybenzene-1-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
5-(1,3-dioxoisoindol-2-yl)-2-methoxybenzenesulfonyl chloride (CAS 885279-82-3) is a chemical compound with the molecular formula C15H10ClNO5S and a molecular weight of 351.8 g/mol. IUPAC name: 5-(1,3-dioxoisoindol-2-yl)-2-methoxybenzenesulfonyl chloride. InChIKey: NXTGLPOAHUQHMP-UHFFFAOYSA-N.
| Molecular formula | C15H10ClNO5S |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | 5-(1,3-dioxoisoindol-2-yl)-2-methoxybenzenesulfonyl chloride |
| InChIKey | NXTGLPOAHUQHMP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2C(=O)C3=CC=CC=C3C2=O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)