Products 88543-33-3

CAS 88543-33-3 is the registry number for Idebenone Impurity 5. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.

Structural formula: {0} (CAS {1})

2-hydroxy-6-(10-hydroxydecyl)-3-methoxy-5-methylcyclohexa-2,5-diene-1,4-dione (CAS 88543-33-3) is a chemical compound with the molecular formula C18H28O5 and a molecular weight of 324.4 g/mol. IUPAC name: 2-hydroxy-6-(10-hydroxydecyl)-3-methoxy-5-methylcyclohexa-2,5-diene-1,4-dione. InChIKey: AZTPTHOKAMPNTB-UHFFFAOYSA-N.

Identity
Molecular formulaC18H28O5
Molecular weight324.4 g/mol
IUPAC name2-hydroxy-6-(10-hydroxydecyl)-3-methoxy-5-methylcyclohexa-2,5-diene-1,4-dione
InChIKeyAZTPTHOKAMPNTB-UHFFFAOYSA-N
SMILESCC1=C(C(=O)C(=C(C1=O)OC)O)CCCCCCCCCCO

Computed by PubChem (NCBI)