CAS 885456-29-1 is the registry number for 1-Butyl-2,3-dimethyl-1H-imidazol-3-ium 4-methylbenzenesulfonate, 98%. Offered by: AmBeed. Available pack sizes: 25g.
1-butyl-2,3-dimethylimidazol-3-ium;4-methylbenzenesulfonate (CAS 885456-29-1) is a chemical compound with the molecular formula C16H24N2O3S and a molecular weight of 324.4 g/mol. IUPAC name: 1-butyl-2,3-dimethylimidazol-3-ium;4-methylbenzenesulfonate. InChIKey: ARGGICXKOZNODB-UHFFFAOYSA-M.
| Molecular formula | C16H24N2O3S |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 1-butyl-2,3-dimethylimidazol-3-ium;4-methylbenzenesulfonate |
| InChIKey | ARGGICXKOZNODB-UHFFFAOYSA-M |
| SMILES | CCCCN1C=C[N+](=C1C)C.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)