CAS 885460-95-7 is the registry number for 4-(9H-Fluoren-3-yl)-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-(9H-fluoren-3-yl)-1,3-thiazol-2-amine (CAS 885460-95-7) is a chemical compound with the molecular formula C16H12N2S and a molecular weight of 264.3 g/mol. IUPAC name: 4-(9H-fluoren-3-yl)-1,3-thiazol-2-amine. InChIKey: LTQJZSRNRYWUSV-UHFFFAOYSA-N.
| Molecular formula | C16H12N2S |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 4-(9H-fluoren-3-yl)-1,3-thiazol-2-amine |
| InChIKey | LTQJZSRNRYWUSV-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C3=CSC(=N3)N)C4=CC=CC=C41 |
Computed by PubChem (NCBI)