CAS 885461-52-9 is the registry number for 2-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)-N-(4-sulfamoylphenyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(4-sulfamoylphenyl)acetamide (CAS 885461-52-9) is a chemical compound with the molecular formula C11H11ClN4O4S and a molecular weight of 330.75 g/mol. IUPAC name: 2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(4-sulfamoylphenyl)acetamide. InChIKey: YRNYYDBNKGJLKF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4O4S |
|---|---|
| Molecular weight | 330.75 g/mol |
| IUPAC name | 2-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(4-sulfamoylphenyl)acetamide |
| InChIKey | YRNYYDBNKGJLKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CC2=NOC(=N2)CCl)S(=O)(=O)N |
Computed by PubChem (NCBI)