CAS 88547-24-4 appears in our catalog under these names: (S)-2-Acetamido-4-methylpent-4-enoic acid, 97%, Ac-4,5-dehydro-leu-oh, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 50mg, 250mg, 100mg.
(2S)-2-acetamido-4-methylpent-4-enoic acid (CAS 88547-24-4) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: (2S)-2-acetamido-4-methylpent-4-enoic acid. InChIKey: XWBXANFRXWKOCS-ZETCQYMHSA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methylpent-4-enoic acid |
| InChIKey | XWBXANFRXWKOCS-ZETCQYMHSA-N |
| SMILES | CC(=C)C[C@@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)