Products 885498-60-2

CAS 885498-60-2 is the registry number for Ethyl 2–amino–4–fluoro–4–methylpentanoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-4-fluoro-4-methylpentanoate (CAS 885498-60-2) is a chemical compound with the molecular formula C8H16FNO2 and a molecular weight of 177.22 g/mol. IUPAC name: ethyl 2-amino-4-fluoro-4-methylpentanoate. InChIKey: MJEBOMLXSMSDDI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16FNO2
Molecular weight177.22 g/mol
IUPAC nameethyl 2-amino-4-fluoro-4-methylpentanoate
InChIKeyMJEBOMLXSMSDDI-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC(C)(C)F)N

Computed by PubChem (NCBI)