CAS 885519-97-1 appears in our catalog under these names: 6-Chloro-3-iodo-4-nitro-1H-indazole, 97%, 97%, 6–Chloro–3–iodo–4–nitro–1H–indazole. Offered by: Chemat, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
6-chloro-3-iodo-4-nitro-2H-indazole (CAS 885519-97-1) is a chemical compound with the molecular formula C7H3ClIN3O2 and a molecular weight of 323.47 g/mol. IUPAC name: 6-chloro-3-iodo-4-nitro-2H-indazole. InChIKey: FADCULZWTHEJND-UHFFFAOYSA-N.
| Molecular formula | C7H3ClIN3O2 |
|---|---|
| Molecular weight | 323.47 g/mol |
| IUPAC name | 6-chloro-3-iodo-4-nitro-2H-indazole |
| InChIKey | FADCULZWTHEJND-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C(NN=C21)I)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)