CAS 885590-86-3 appears in our catalog under these names: 2',3'-Difluoro-4'-iodoacetophenone, 95%, 2',3'-Difluoro-4'-iodoacetophenone, 98%, 1-(2,3-Difluoro-4-iodophenyl)ethanone, ≥95%, ≥95%, 1-(2,3-Difluoro-4-iodophenyl)ethanone. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
1-(2,3-difluoro-4-iodophenyl)ethanone (CAS 885590-86-3) is a chemical compound with the molecular formula C8H5F2IO and a molecular weight of 282.03 g/mol. IUPAC name: 1-(2,3-difluoro-4-iodophenyl)ethanone. InChIKey: PAGYSIHHHPGULF-UHFFFAOYSA-N.
| Molecular formula | C8H5F2IO |
|---|---|
| Molecular weight | 282.03 g/mol |
| IUPAC name | 1-(2,3-difluoro-4-iodophenyl)ethanone |
| InChIKey | PAGYSIHHHPGULF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)I)F)F |
Computed by PubChem (NCBI)