CAS 885594-74-1 is the registry number for tert-Butyl (3-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2- yl)phenoxy)propyl)carbamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
Tert-butyl N-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamate (CAS 885594-74-1) is a chemical compound with the molecular formula C20H32BNO5 and a molecular weight of 377.3 g/mol. IUPAC name: tert-butyl N-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamate. InChIKey: SCQJOJIGWKDLQR-UHFFFAOYSA-N.
| Molecular formula | C20H32BNO5 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | tert-butyl N-[3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]carbamate |
| InChIKey | SCQJOJIGWKDLQR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)