Products 88585-86-8
CAS 88585-86-8 is the registry number for Isomexoticin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
8-[(2S)-2,3-dihydroxy-3-methylbutyl]-5,7-dimethoxychromen-2-one (CAS 88585-86-8) is a chemical compound with the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. IUPAC name: 8-[(2S)-2,3-dihydroxy-3-methylbutyl]-5,7-dimethoxychromen-2-one. InChIKey: JVCJUTNJQMKKCK-ZDUSSCGKSA-N.
| Molecular formula | C16H20O6 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 8-[(2S)-2,3-dihydroxy-3-methylbutyl]-5,7-dimethoxychromen-2-one |
| InChIKey | JVCJUTNJQMKKCK-ZDUSSCGKSA-N |
| SMILES | CC(C)([C@H](CC1=C(C=C(C2=C1OC(=O)C=C2)OC)OC)O)O |
Computed by PubChem (NCBI)