CAS 885949-67-7 appears in our catalog under these names: Perfluorophenyl 5-bromothiophene-2-sulfonate, 95+%, Pentafluorophenyl 5-bromo-thiophene-2-sulfonate, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 5g.
(2,3,4,5,6-pentafluorophenyl) 5-bromothiophene-2-sulfonate (CAS 885949-67-7) is a chemical compound with the molecular formula C10H2BrF5O3S2 and a molecular weight of 409.2 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 5-bromothiophene-2-sulfonate. InChIKey: ARONUGGUBQPRMS-UHFFFAOYSA-N.
| Molecular formula | C10H2BrF5O3S2 |
|---|---|
| Molecular weight | 409.2 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 5-bromothiophene-2-sulfonate |
| InChIKey | ARONUGGUBQPRMS-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)S(=O)(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)