Products 885950-39-0

CAS 885950-39-0 is the registry number for 2,3,4,5,6-Pentafluorophenyl 4-iodobenzenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2,3,4,5,6-pentafluorophenyl) 4-iodobenzenesulfonate (CAS 885950-39-0) is a chemical compound with the molecular formula C12H4F5IO3S and a molecular weight of 450.12 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 4-iodobenzenesulfonate. InChIKey: AZZVZQPDNUPFDF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H4F5IO3S
Molecular weight450.12 g/mol
IUPAC name(2,3,4,5,6-pentafluorophenyl) 4-iodobenzenesulfonate
InChIKeyAZZVZQPDNUPFDF-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1S(=O)(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)I

Computed by PubChem (NCBI)