CAS 885950-39-0 is the registry number for 2,3,4,5,6-Pentafluorophenyl 4-iodobenzenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2,3,4,5,6-pentafluorophenyl) 4-iodobenzenesulfonate (CAS 885950-39-0) is a chemical compound with the molecular formula C12H4F5IO3S and a molecular weight of 450.12 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 4-iodobenzenesulfonate. InChIKey: AZZVZQPDNUPFDF-UHFFFAOYSA-N.
| Molecular formula | C12H4F5IO3S |
|---|---|
| Molecular weight | 450.12 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 4-iodobenzenesulfonate |
| InChIKey | AZZVZQPDNUPFDF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)OC2=C(C(=C(C(=C2F)F)F)F)F)I |
Computed by PubChem (NCBI)