Products 885950-81-2
CAS 885950-81-2 is the registry number for 2-(3,5-Bis(trifluoromethyl)phenyl)-2-phenylacetic acid. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg.
2-[3,5-bis(trifluoromethyl)phenyl]-2-phenylacetic acid (CAS 885950-81-2) is a chemical compound with the molecular formula C16H10F6O2 and a molecular weight of 348.24 g/mol. IUPAC name: 2-[3,5-bis(trifluoromethyl)phenyl]-2-phenylacetic acid. InChIKey: CXFICADTZIDJIC-UHFFFAOYSA-N.
| Molecular formula | C16H10F6O2 |
|---|---|
| Molecular weight | 348.24 g/mol |
| IUPAC name | 2-[3,5-bis(trifluoromethyl)phenyl]-2-phenylacetic acid |
| InChIKey | CXFICADTZIDJIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)