Products 885950-96-9

CAS 885950-96-9 appears in our catalog under these names: 2-(2-Chlorophenyl)-2-phenylethylsulfonyl chloride, 95%, 2-(2-Chlorophenyl)-2-phenylethanesulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

2-(2-chlorophenyl)-2-phenylethanesulfonyl chloride (CAS 885950-96-9) is a chemical compound with the molecular formula C14H12Cl2O2S and a molecular weight of 315.2 g/mol. IUPAC name: 2-(2-chlorophenyl)-2-phenylethanesulfonyl chloride. InChIKey: IUVNCPUXUXDWNE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12Cl2O2S
Molecular weight315.2 g/mol
IUPAC name2-(2-chlorophenyl)-2-phenylethanesulfonyl chloride
InChIKeyIUVNCPUXUXDWNE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(CS(=O)(=O)Cl)C2=CC=CC=C2Cl

Computed by PubChem (NCBI)