CAS 885959-36-4 appears in our catalog under these names: 4-(Pyrrolidin-3-yl)piperazine-1-carboxylic Acid tert-Butyl Ester, Tert-butyl 4-(pyrrolidin-3-yl)piperazine-1-carboxylate, 98%, 98%, tert-Butyl 4-(pyrrolidin-3-yl)piperazine-1-carboxylate, 95%. Offered by: TRC, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 2,5g, 1g, 100mg, 250mg, 500mg, 5g, 10g.
Tert-butyl 4-pyrrolidin-3-ylpiperazine-1-carboxylate (CAS 885959-36-4) is a chemical compound with the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. IUPAC name: tert-butyl 4-pyrrolidin-3-ylpiperazine-1-carboxylate. InChIKey: IZAYUAGLMWGXRH-UHFFFAOYSA-N.
| Molecular formula | C13H25N3O2 |
|---|---|
| Molecular weight | 255.36 g/mol |
| IUPAC name | tert-butyl 4-pyrrolidin-3-ylpiperazine-1-carboxylate |
| InChIKey | IZAYUAGLMWGXRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2CCNC2 |
Computed by PubChem (NCBI)