CAS 88600-65-1 is the registry number for 1,4,5,8-Tetraamino-2,7-bis(p-tolyloxy)anthracene-9,10-dione, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,4,5,8-tetraamino-2,7-bis(4-methylphenoxy)anthracene-9,10-dione (CAS 88600-65-1) is a chemical compound with the molecular formula C28H24N4O4 and a molecular weight of 480.5 g/mol. IUPAC name: 1,4,5,8-tetraamino-2,7-bis(4-methylphenoxy)anthracene-9,10-dione. InChIKey: PLYPLAUCKLLNLL-UHFFFAOYSA-N.
| Molecular formula | C28H24N4O4 |
|---|---|
| Molecular weight | 480.5 g/mol |
| IUPAC name | 1,4,5,8-tetraamino-2,7-bis(4-methylphenoxy)anthracene-9,10-dione |
| InChIKey | PLYPLAUCKLLNLL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=C(C3=C(C(=C2)N)C(=O)C4=C(C3=O)C(=C(C=C4N)OC5=CC=C(C=C5)C)N)N |
Computed by PubChem (NCBI)