CAS 88613-62-1 is the registry number for 1-N,N-Dimethylamino-4-(2-thienyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
N,N-dimethyl-4-thiophen-2-ylaniline (CAS 88613-62-1) is a chemical compound with the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. IUPAC name: N,N-dimethyl-4-thiophen-2-ylaniline. InChIKey: OBOJATQRERVNCF-UHFFFAOYSA-N.
| Molecular formula | C12H13NS |
|---|---|
| Molecular weight | 203.31 g/mol |
| IUPAC name | N,N-dimethyl-4-thiophen-2-ylaniline |
| InChIKey | OBOJATQRERVNCF-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC=CS2 |
Computed by PubChem (NCBI)