Products 88633-12-9
CAS 88633-12-9 is the registry number for 1,2,3,5,6,7-Hexahydro-s-indacene-4-carbaldehyde, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg.
1,2,3,5,6,7-hexahydro-s-indacene-4-carbaldehyde (CAS 88633-12-9) is a chemical compound with the molecular formula C13H14O and a molecular weight of 186.25 g/mol. IUPAC name: 1,2,3,5,6,7-hexahydro-s-indacene-4-carbaldehyde. InChIKey: CUXFHFJLCGRZEB-UHFFFAOYSA-N.
| Molecular formula | C13H14O |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 1,2,3,5,6,7-hexahydro-s-indacene-4-carbaldehyde |
| InChIKey | CUXFHFJLCGRZEB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(CCC3)C(=C2C1)C=O |
Computed by PubChem (NCBI)